About tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane
tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane (PubChem CID 25224044) has the molecular formula C21H38O2Si
and a molecular weight of 350.62 g/mol. Its IUPAC name is tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane.
Molecular Properties
| Compound Name | tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane |
| PubChem CID | 25224044 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane |
| SMILES | C=CCOC[C@@H](/C=C\CC)OCC#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-9-11-13-21(17-22-14-10-2)23-15-12-16-24(18(3)4,19(5)6)20(7)8/h10-11,13,18-21H,2,9,14-15,17H2,1,3-8H3/b13-11-/t21-/m1/s1 |
| InChIKey | CJYWQPZYYNIBJL-JNSUZQQQSA-N |
| XLogP | 5.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane?
The IUPAC name of tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane (CID 25224044) is tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane.
What is the SMILES notation for tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane?
The canonical SMILES for tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane is C=CCOC[C@@H](/C=C\CC)OCC#C[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane?
The InChIKey is CJYWQPZYYNIBJL-JNSUZQQQSA-N. The full InChI is InChI=1S/C21H38O2Si/c1-9-11-13-21(17-22-14-10-2)23-15-12-16-24(18(3)4,19(5)6)20(7)8/h10-11,13,18-21H,2,9,14-15,17H2,1,3-8H3/b13-11-/t21-/m1/s1.
What are the key properties of tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane?
tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane has a molecular weight of 350.62 g/mol, XLogP of 5.76, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tri(propan-2-yl)-[3-[(Z,2R)-1-prop-2-enoxyhex-3-en-2-yl]oxyprop-1-ynyl]silane is sourced from PubChem (CID 25224044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).