C28H25NO7 — CID 25224087
(2S,3R,4S,4aR)-5-benzyl-2,3,4-trihydroxy-7-phenylmethoxy-2,3,4,4a-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-6-one (PubChem CID 25224087) has the molecular formula C28H25NO7 and a molecular weight of 487.51 g/mol. Its IUPAC name is (2S,3R,4S,4aR)-5-benzyl-2,3,4-trihydroxy-7-phenylmethoxy-2,3,4,4a-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-6-one.
| Compound Name | (2S,3R,4S,4aR)-5-benzyl-2,3,4-trihydroxy-7-phenylmethoxy-2,3,4,4a-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
|---|---|
| PubChem CID | 25224087 |
| Molecular Formula | C28H25NO7 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (2S,3R,4S,4aR)-5-benzyl-2,3,4-trihydroxy-7-phenylmethoxy-2,3,4,4a-tetrahydro-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
| SMILES | O=C1c2c(cc3c(c2OCc2ccccc2)OCO3)C2=C[C@H](O)[C@@H](O)[C@@H](O)[C@@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C28H25NO7/c30-20-11-19-18-12-21-26(36-15-35-21)27(34-14-17-9-5-2-6-10-17)22(18)28(33)29(23(19)25(32)24(20)31)13-16-7-3-1-4-8-16/h1-12,20,23-25,30-32H,13-15H2/t20-,23+,24+,25-/m0/s1 |
| InChIKey | HFRAVIVJXGGNLL-KTJVCJKDSA-N |
| XLogP | 2.50 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |