About tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate
tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate (PubChem CID 25224104) has the molecular formula C11H21N5O2
and a molecular weight of 255.32 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate |
| PubChem CID | 25224104 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OC(C)(C)C)c1nn[nH]n1 |
| InChI | InChI=1S/C11H21N5O2/c1-6-7(2)8(9-13-15-16-14-9)12-10(17)18-11(3,4)5/h7-8H,6H2,1-5H3,(H,12,17)(H,13,14,15,16)/t7-,8-/m0/s1 |
| InChIKey | KWCIUMKXJCAOLS-YUMQZZPRSA-N |
| XLogP | 1.81 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate?
The IUPAC name of tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate (CID 25224104) is tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate?
The canonical SMILES for tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate is CC[C@H](C)[C@H](NC(=O)OC(C)(C)C)c1nn[nH]n1.
What is the InChIKey of tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate?
The InChIKey is KWCIUMKXJCAOLS-YUMQZZPRSA-N. The full InChI is InChI=1S/C11H21N5O2/c1-6-7(2)8(9-13-15-16-14-9)12-10(17)18-11(3,4)5/h7-8H,6H2,1-5H3,(H,12,17)(H,13,14,15,16)/t7-,8-/m0/s1.
What are the key properties of tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate?
tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate has a molecular weight of 255.32 g/mol, XLogP of 1.81, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1S,2S)-2-methyl-1-(2H-tetrazol-5-yl)butyl]carbamate is sourced from PubChem (CID 25224104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).