C20H38O5Si — CID 25224268
2-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(E,6S)-6-hydroxyhept-1-enyl]oxan-2-yl]acetic acid (PubChem CID 25224268) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is 2-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(E,6S)-6-hydroxyhept-1-enyl]oxan-2-yl]acetic acid.
| Compound Name | 2-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(E,6S)-6-hydroxyhept-1-enyl]oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 25224268 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 2-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(E,6S)-6-hydroxyhept-1-enyl]oxan-2-yl]acetic acid |
| SMILES | C[C@H](O)CCC/C=C/[C@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC(=O)O)O1 |
| InChI | InChI=1S/C20H38O5Si/c1-15(21)10-8-7-9-11-16-12-13-17(18(24-16)14-19(22)23)25-26(5,6)20(2,3)4/h9,11,15-18,21H,7-8,10,12-14H2,1-6H3,(H,22,23)/b11-9+/t15-,16-,17-,18-/m0/s1 |
| InChIKey | SSGCVTANVWAIGM-ORUAZALISA-N |
| XLogP | 4.51 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|