C20H36O4Si — CID 25224269
(1S,5S,9E,11R,14S)-14-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4,15-dioxabicyclo[9.3.1]pentadec-9-en-3-one (PubChem CID 25224269) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is (1S,5S,9E,11R,14S)-14-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4,15-dioxabicyclo[9.3.1]pentadec-9-en-3-one.
| Compound Name | (1S,5S,9E,11R,14S)-14-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4,15-dioxabicyclo[9.3.1]pentadec-9-en-3-one |
|---|---|
| PubChem CID | 25224269 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (1S,5S,9E,11R,14S)-14-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4,15-dioxabicyclo[9.3.1]pentadec-9-en-3-one |
| SMILES | C[C@H]1CCC/C=C\[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC(=O)O1)O2 |
| InChI | InChI=1S/C20H36O4Si/c1-15-10-8-7-9-11-16-12-13-17(18(23-16)14-19(21)22-15)24-25(5,6)20(2,3)4/h9,11,15-18H,7-8,10,12-14H2,1-6H3/b11-9-/t15-,16-,17-,18-/m0/s1 |
| InChIKey | NZHXSEGISWJNTL-HMOITEHOSA-N |
| XLogP | 4.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|