C31H27ClFN3O6 — CID 25224503
1-[[2-chloro-7-(2,2-dimethylpropanoyloxymethoxy)quinolin-3-yl]methyl]-6-fluoro-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxylic acid (PubChem CID 25224503) has the molecular formula C31H27ClFN3O6 and a molecular weight of 592.02 g/mol. Its IUPAC name is 1-[[2-chloro-7-(2,2-dimethylpropanoyloxymethoxy)quinolin-3-yl]methyl]-6-fluoro-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxylic acid.
| Compound Name | 1-[[2-chloro-7-(2,2-dimethylpropanoyloxymethoxy)quinolin-3-yl]methyl]-6-fluoro-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25224503 |
| Molecular Formula | C31H27ClFN3O6 |
| Molecular Weight | 592.02 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 1-[[2-chloro-7-(2,2-dimethylpropanoyloxymethoxy)quinolin-3-yl]methyl]-6-fluoro-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxylic acid |
| SMILES | Cc1cc2c(-c3ccc[nH]c3=O)c(C(=O)O)n(Cc3cc4ccc(OCOC(=O)C(C)(C)C)cc4nc3Cl)c2cc1F |
| InChI | InChI=1S/C31H27ClFN3O6/c1-16-10-21-24(13-22(16)33)36(26(29(38)39)25(21)20-6-5-9-34-28(20)37)14-18-11-17-7-8-19(12-23(17)35-27(18)32)41-15-42-30(40)31(2,3)4/h5-13H,14-15H2,1-4H3,(H,34,37)(H,38,39) |
| InChIKey | YLRPCVHUURFWHE-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.02 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|