C13H19NO7 — CID 25224651
(2R,3R,4R)-N-[2-(2,6-dihydroxyphenyl)ethyl]-2,3,4,5-tetrahydroxypentanamide (PubChem CID 25224651) has the molecular formula C13H19NO7 and a molecular weight of 301.29 g/mol. Its IUPAC name is (2R,3R,4R)-N-[2-(2,6-dihydroxyphenyl)ethyl]-2,3,4,5-tetrahydroxypentanamide.
| Compound Name | (2R,3R,4R)-N-[2-(2,6-dihydroxyphenyl)ethyl]-2,3,4,5-tetrahydroxypentanamide |
|---|---|
| PubChem CID | 25224651 |
| Molecular Formula | C13H19NO7 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (2R,3R,4R)-N-[2-(2,6-dihydroxyphenyl)ethyl]-2,3,4,5-tetrahydroxypentanamide |
| SMILES | O=C(NCCc1c(O)cccc1O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H19NO7/c15-6-10(18)11(19)12(20)13(21)14-5-4-7-8(16)2-1-3-9(7)17/h1-3,10-12,15-20H,4-6H2,(H,14,21)/t10-,11-,12-/m1/s1 |
| InChIKey | NEOOQFFZTHKUKL-IJLUTSLNSA-N |
| XLogP | -2.17 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |