C16H25NO2 — CID 25225145
2,2,3,3,4,4,5,5,6,6-decadeuterio-1-[2,2-dideuterio-2-(dimethylamino)-1-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)ethyl]cyclohexan-1-ol (PubChem CID 25225145) has the molecular formula C16H25NO2 and a molecular weight of 279.48 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decadeuterio-1-[2,2-dideuterio-2-(dimethylamino)-1-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)ethyl]cyclohexan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decadeuterio-1-[2,2-dideuterio-2-(dimethylamino)-1-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 25225145 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 279.48 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decadeuterio-1-[2,2-dideuterio-2-(dimethylamino)-1-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)ethyl]cyclohexan-1-ol |
| SMILES | [2H]c1c([2H])c(C(C([2H])([2H])N(C)C)C2(O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C2([2H])[2H])c([2H])c([2H])c1O |
| InChI | InChI=1S/C16H25NO2/c1-17(2)12-15(13-6-8-14(18)9-7-13)16(19)10-4-3-5-11-16/h6-9,15,18-19H,3-5,10-12H2,1-2H3/i3D2,4D2,5D2,6D,7D,8D,9D,10D2,11D2,12D2 |
| InChIKey | KYYIDSXMWOZKMP-XNQFKFPBSA-N |
| XLogP | 2.73 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |