C17H23N3O3S — CID 25225457
ethyl 2-(1-adamantylcarbamoylamino)-1,3-thiazole-5-carboxylate (PubChem CID 25225457) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is ethyl 2-(1-adamantylcarbamoylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(1-adamantylcarbamoylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 25225457 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | ethyl 2-(1-adamantylcarbamoylamino)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(=O)NC23CC4CC(CC(C4)C2)C3)s1 |
| InChI | InChI=1S/C17H23N3O3S/c1-2-23-14(21)13-9-18-16(24-13)19-15(22)20-17-6-10-3-11(7-17)5-12(4-10)8-17/h9-12H,2-8H2,1H3,(H2,18,19,20,22) |
| InChIKey | LHDZMNJGIYCLNL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |