C17H24N4O4S2 — CID 25226004
N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N'-hydroxyhexanediamide (PubChem CID 25226004) has the molecular formula C17H24N4O4S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N'-hydroxyhexanediamide.
| Compound Name | N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 25226004 |
| Molecular Formula | C17H24N4O4S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-N'-hydroxyhexanediamide |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(NC(=O)CCCCC(=O)NO)s2)o1 |
| InChI | InChI=1S/C17H24N4O4S2/c1-17(2,3)11-8-18-14(25-11)10-26-15-9-19-16(27-15)20-12(22)6-4-5-7-13(23)21-24/h8-9,24H,4-7,10H2,1-3H3,(H,21,23)(H,19,20,22) |
| InChIKey | SNMMJBCMTCRCSM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|