C18H27N5O4S2 — CID 25226543
N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N'-hydroxyoctanediamide (PubChem CID 25226543) has the molecular formula C18H27N5O4S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N'-hydroxyoctanediamide.
| Compound Name | N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 25226543 |
| Molecular Formula | C18H27N5O4S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-N'-hydroxyoctanediamide |
| SMILES | CC(C)(C)c1cnc(CSc2nnc(NC(=O)CCCCCCC(=O)NO)s2)o1 |
| InChI | InChI=1S/C18H27N5O4S2/c1-18(2,3)12-10-19-15(27-12)11-28-17-22-21-16(29-17)20-13(24)8-6-4-5-7-9-14(25)23-26/h10,26H,4-9,11H2,1-3H3,(H,23,25)(H,20,21,24) |
| InChIKey | SFFVSTJETORIBV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|