C28H32FN3O3S — CID 25226621
N-benzyl-1-[2-(N-(3-fluorophenyl)-4-methylsulfonylanilino)ethyl]piperidine-4-carboxamide (PubChem CID 25226621) has the molecular formula C28H32FN3O3S and a molecular weight of 509.65 g/mol. Its IUPAC name is N-benzyl-1-[2-(N-(3-fluorophenyl)-4-methylsulfonylanilino)ethyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[2-(N-(3-fluorophenyl)-4-methylsulfonylanilino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25226621 |
| Molecular Formula | C28H32FN3O3S |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-benzyl-1-[2-(N-(3-fluorophenyl)-4-methylsulfonylanilino)ethyl]piperidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(N(CCN2CCC(C(=O)NCc3ccccc3)CC2)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C28H32FN3O3S/c1-36(34,35)27-12-10-25(11-13-27)32(26-9-5-8-24(29)20-26)19-18-31-16-14-23(15-17-31)28(33)30-21-22-6-3-2-4-7-22/h2-13,20,23H,14-19,21H2,1H3,(H,30,33) |
| InChIKey | WLGPQOHKWZGVHT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |