C24H15F3N4O2 — CID 25226942
9-[6-(hydroxymethyl)-3-pyridinyl]-5-(2,4,6-trifluoroanilino)-2H-benzo[h][2,6]naphthyridin-1-one (PubChem CID 25226942) has the molecular formula C24H15F3N4O2 and a molecular weight of 448.40 g/mol. Its IUPAC name is 9-[6-(hydroxymethyl)-3-pyridinyl]-5-(2,4,6-trifluoroanilino)-2H-benzo[h][2,6]naphthyridin-1-one.
| Compound Name | 9-[6-(hydroxymethyl)-3-pyridinyl]-5-(2,4,6-trifluoroanilino)-2H-benzo[h][2,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25226942 |
| Molecular Formula | C24H15F3N4O2 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 9-[6-(hydroxymethyl)-3-pyridinyl]-5-(2,4,6-trifluoroanilino)-2H-benzo[h][2,6]naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2c(Nc3c(F)cc(F)cc3F)nc3ccc(-c4ccc(CO)nc4)cc3c12 |
| InChI | InChI=1S/C24H15F3N4O2/c25-14-8-18(26)22(19(27)9-14)31-23-16-5-6-28-24(33)21(16)17-7-12(2-4-20(17)30-23)13-1-3-15(11-32)29-10-13/h1-10,32H,11H2,(H,28,33)(H,30,31) |
| InChIKey | BPEJTWHMYLFHAR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|