About 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione
2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione (PubChem CID 25227361) has the molecular formula C18H20FN5O2S
and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione.
Molecular Properties
| Compound Name | 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione |
| PubChem CID | 25227361 |
| Molecular Formula | C18H20FN5O2S |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione |
| SMILES | CCCCSc1nc(NC)c2[nH]c(=O)c(=O)n(Cc3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C18H20FN5O2S/c1-3-4-9-27-18-22-14(20-2)13-15(23-18)24(17(26)16(25)21-13)10-11-5-7-12(19)8-6-11/h5-8H,3-4,9-10H2,1-2H3,(H,21,25)(H,20,22,23) |
| InChIKey | VXMILTBKDWEHOY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione?
The IUPAC name of 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione (CID 25227361) is 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione.
What is the SMILES notation for 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione?
The canonical SMILES for 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione is CCCCSc1nc(NC)c2[nH]c(=O)c(=O)n(Cc3ccc(F)cc3)c2n1.
What is the InChIKey of 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione?
The InChIKey is VXMILTBKDWEHOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN5O2S/c1-3-4-9-27-18-22-14(20-2)13-15(23-18)24(17(26)16(25)21-13)10-11-5-7-12(19)8-6-11/h5-8H,3-4,9-10H2,1-2H3,(H,21,25)(H,20,22,23).
What are the key properties of 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione?
2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione has a molecular weight of 389.46 g/mol, XLogP of 2.60, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylsulfanyl-8-[(4-fluorophenyl)methyl]-4-(methylamino)-5H-pteridine-6,7-dione is sourced from PubChem (CID 25227361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).