C35H53NO3Si — CID 25227661
tert-butyl (4aS,8aR)-5-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate (PubChem CID 25227661) has the molecular formula C35H53NO3Si and a molecular weight of 563.90 g/mol. Its IUPAC name is tert-butyl (4aS,8aR)-5-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl (4aS,8aR)-5-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 25227661 |
| Molecular Formula | C35H53NO3Si |
| Molecular Weight | 563.90 g/mol |
| Exact Mass | 563.38 |
| IUPAC Name | tert-butyl (4aS,8aR)-5-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]2C(CCCCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CCC[C@H]21 |
| InChI | InChI=1S/C35H53NO3Si/c1-34(2,3)39-33(37)36-26-17-24-31-28(19-16-25-32(31)36)18-10-9-15-27-38-40(35(4,5)6,29-20-11-7-12-21-29)30-22-13-8-14-23-30/h7-8,11-14,20-23,28,31-32H,9-10,15-19,24-27H2,1-6H3/t28?,31-,32+/m0/s1 |
| InChIKey | RZSYDIYOJFQVGJ-VICIGFPDSA-N |
| XLogP | 7.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.90 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|