C29H45N3O3 — CID 25227680
(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-16-(2-azidoethoxy)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane] (PubChem CID 25227680) has the molecular formula C29H45N3O3 and a molecular weight of 483.70 g/mol. Its IUPAC name is (1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-16-(2-azidoethoxy)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane].
| Compound Name | (1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-16-(2-azidoethoxy)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane] |
|---|---|
| PubChem CID | 25227680 |
| Molecular Formula | C29H45N3O3 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | (1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-16-(2-azidoethoxy)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane] |
| SMILES | CC1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC=C5C[C@@H](OCCN=[N+]=[N-])CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| InChI | InChI=1S/C29H45N3O3/c1-18-7-12-29(34-17-18)19(2)26-25(35-29)16-24-22-6-5-20-15-21(33-14-13-31-32-30)8-10-27(20,3)23(22)9-11-28(24,26)4/h5,18-19,21-26H,6-17H2,1-4H3/t18?,19-,21-,22+,23-,24-,25-,26-,27-,28-,29+/m0/s1 |
| InChIKey | ZWGNMQYNGXBOSC-XYHBTRBKSA-N |
| XLogP | 7.05 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|