C29H37NO5Si — CID 25227710
tert-butyl (1S,2S,5R)-2-[(1S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 25227710) has the molecular formula C29H37NO5Si and a molecular weight of 507.70 g/mol. Its IUPAC name is tert-butyl (1S,2S,5R)-2-[(1S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | tert-butyl (1S,2S,5R)-2-[(1S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 25227710 |
| Molecular Formula | C29H37NO5Si |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | tert-butyl (1S,2S,5R)-2-[(1S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-enyl]-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | C=CC[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1OC(=O)[C@H]2[C@@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H37NO5Si/c1-8-15-22(25-23-24(26(31)33-25)30(23)27(32)34-28(2,3)4)35-36(29(5,6)7,20-16-11-9-12-17-20)21-18-13-10-14-19-21/h8-14,16-19,22-25H,1,15H2,2-7H3/t22-,23-,24+,25+,30?/m0/s1 |
| InChIKey | XRFHRJMDVLKZQM-ZJKPLRQGSA-N |
| XLogP | 4.42 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|