C22H42O2Si — CID 25228012
(7E)-3,3,7-trimethyl-4-triethylsilyloxytrideca-7,12-dienal (PubChem CID 25228012) has the molecular formula C22H42O2Si and a molecular weight of 366.66 g/mol. Its IUPAC name is (7E)-3,3,7-trimethyl-4-triethylsilyloxytrideca-7,12-dienal.
| Compound Name | (7E)-3,3,7-trimethyl-4-triethylsilyloxytrideca-7,12-dienal |
|---|---|
| PubChem CID | 25228012 |
| Molecular Formula | C22H42O2Si |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | (7E)-3,3,7-trimethyl-4-triethylsilyloxytrideca-7,12-dienal |
| SMILES | C=CCCC/C=C(\C)CCC(O[Si](CC)(CC)CC)C(C)(C)CC=O |
| InChI | InChI=1S/C22H42O2Si/c1-8-12-13-14-15-20(5)16-17-21(22(6,7)18-19-23)24-25(9-2,10-3)11-4/h8,15,19,21H,1,9-14,16-18H2,2-7H3/b20-15+ |
| InChIKey | XFDNRPCAAQUXJC-HMMYKYKNSA-N |
| XLogP | 7.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|