C12H20BrNO2 — CID 25228068
(2R,3S,5Z,8R)-3-bromo-2-ethyl-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide (PubChem CID 25228068) has the molecular formula C12H20BrNO2 and a molecular weight of 290.20 g/mol. Its IUPAC name is (2R,3S,5Z,8R)-3-bromo-2-ethyl-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide.
| Compound Name | (2R,3S,5Z,8R)-3-bromo-2-ethyl-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide |
|---|---|
| PubChem CID | 25228068 |
| Molecular Formula | C12H20BrNO2 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (2R,3S,5Z,8R)-3-bromo-2-ethyl-N,N-dimethyl-3,4,7,8-tetrahydro-2H-oxocine-8-carboxamide |
| SMILES | CC[C@H]1O[C@@H](C(=O)N(C)C)C/C=C\C[C@@H]1Br |
| InChI | InChI=1S/C12H20BrNO2/c1-4-10-9(13)7-5-6-8-11(16-10)12(15)14(2)3/h5-6,9-11H,4,7-8H2,1-3H3/b6-5-/t9-,10+,11+/m0/s1 |
| InChIKey | SNYSVYAXQRLYSC-KCFTWOIDSA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|