C15H35FO5Si3 — CID 25228157
(3S,4R,5S)-5-[(1R)-2-fluoro-1-trimethylsilyloxyethyl]-3,4-bis(trimethylsilyloxy)oxolan-2-ol (PubChem CID 25228157) has the molecular formula C15H35FO5Si3 and a molecular weight of 398.70 g/mol. Its IUPAC name is (3S,4R,5S)-5-[(1R)-2-fluoro-1-trimethylsilyloxyethyl]-3,4-bis(trimethylsilyloxy)oxolan-2-ol.
| Compound Name | (3S,4R,5S)-5-[(1R)-2-fluoro-1-trimethylsilyloxyethyl]-3,4-bis(trimethylsilyloxy)oxolan-2-ol |
|---|---|
| PubChem CID | 25228157 |
| Molecular Formula | C15H35FO5Si3 |
| Molecular Weight | 398.70 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (3S,4R,5S)-5-[(1R)-2-fluoro-1-trimethylsilyloxyethyl]-3,4-bis(trimethylsilyloxy)oxolan-2-ol |
| SMILES | C[Si](C)(C)O[C@@H]1[C@@H]([C@H](CF)O[Si](C)(C)C)OC(O)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C15H35FO5Si3/c1-22(2,3)19-11(10-16)12-13(20-23(4,5)6)14(15(17)18-12)21-24(7,8)9/h11-15,17H,10H2,1-9H3/t11-,12+,13+,14-,15?/m0/s1 |
| InChIKey | GPKZTEPRPMZMKA-LUNVINKVSA-N |
| XLogP | 3.33 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.70 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|