C15H22O2Si — CID 25228306
3-cyclohexyl-3-methyl-1,5-dihydro-2,4,3-benzodioxasilepine (PubChem CID 25228306) has the molecular formula C15H22O2Si and a molecular weight of 262.42 g/mol. Its IUPAC name is 3-cyclohexyl-3-methyl-1,5-dihydro-2,4,3-benzodioxasilepine.
| Compound Name | 3-cyclohexyl-3-methyl-1,5-dihydro-2,4,3-benzodioxasilepine |
|---|---|
| PubChem CID | 25228306 |
| Molecular Formula | C15H22O2Si |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-cyclohexyl-3-methyl-1,5-dihydro-2,4,3-benzodioxasilepine |
| SMILES | C[Si]1(C2CCCCC2)OCc2ccccc2CO1 |
| InChI | InChI=1S/C15H22O2Si/c1-18(15-9-3-2-4-10-15)16-11-13-7-5-6-8-14(13)12-17-18/h5-8,15H,2-4,9-12H2,1H3 |
| InChIKey | IVKVFNSUXBPRIE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|