C13H28OSi — CID 25228317
tert-butyl-dimethyl-[(3R,4R)-4-methylhex-5-en-3-yl]oxysilane (PubChem CID 25228317) has the molecular formula C13H28OSi and a molecular weight of 228.45 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R,4R)-4-methylhex-5-en-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3R,4R)-4-methylhex-5-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 25228317 |
| Molecular Formula | C13H28OSi |
| Molecular Weight | 228.45 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | tert-butyl-dimethyl-[(3R,4R)-4-methylhex-5-en-3-yl]oxysilane |
| SMILES | C=C[C@@H](C)[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28OSi/c1-9-11(3)12(10-2)14-15(7,8)13(4,5)6/h9,11-12H,1,10H2,2-8H3/t11-,12-/m1/s1 |
| InChIKey | GWJFTBRGIXMLSK-VXGBXAGGSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|