About 6-chloro-4H-pyrrolo[1,2-a]indole
6-chloro-4H-pyrrolo[1,2-a]indole (PubChem CID 25228432) has the molecular formula C11H8ClN
and a molecular weight of 189.65 g/mol. Its IUPAC name is 6-chloro-4H-pyrrolo[1,2-a]indole.
Molecular Properties
| Compound Name | 6-chloro-4H-pyrrolo[1,2-a]indole |
| PubChem CID | 25228432 |
| Molecular Formula | C11H8ClN |
| Molecular Weight | 189.65 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | 6-chloro-4H-pyrrolo[1,2-a]indole |
| SMILES | Clc1ccc2c(c1)Cc1cccn1-2 |
| InChI | InChI=1S/C11H8ClN/c12-9-3-4-11-8(6-9)7-10-2-1-5-13(10)11/h1-6H,7H2 |
| InChIKey | QCZMDGFBNHDSKT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-4H-pyrrolo[1,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4H-pyrrolo[1,2-a]indole?
The IUPAC name of 6-chloro-4H-pyrrolo[1,2-a]indole (CID 25228432) is 6-chloro-4H-pyrrolo[1,2-a]indole.
What is the SMILES notation for 6-chloro-4H-pyrrolo[1,2-a]indole?
The canonical SMILES for 6-chloro-4H-pyrrolo[1,2-a]indole is Clc1ccc2c(c1)Cc1cccn1-2.
What is the InChIKey of 6-chloro-4H-pyrrolo[1,2-a]indole?
The InChIKey is QCZMDGFBNHDSKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN/c12-9-3-4-11-8(6-9)7-10-2-1-5-13(10)11/h1-6H,7H2.
What are the key properties of 6-chloro-4H-pyrrolo[1,2-a]indole?
6-chloro-4H-pyrrolo[1,2-a]indole has a molecular weight of 189.65 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4H-pyrrolo[1,2-a]indole is sourced from PubChem (CID 25228432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).