C13H17ClN2O2 — CID 25229111
methyl 1-[(2-chloro-3-pyridinyl)methyl]piperidine-3-carboxylate (PubChem CID 25229111) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is methyl 1-[(2-chloro-3-pyridinyl)methyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[(2-chloro-3-pyridinyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 25229111 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | methyl 1-[(2-chloro-3-pyridinyl)methyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(Cc2cccnc2Cl)C1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-18-13(17)11-5-3-7-16(9-11)8-10-4-2-6-15-12(10)14/h2,4,6,11H,3,5,7-9H2,1H3 |
| InChIKey | CIXRLVXYCQKPMR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|