C21H27NO2 — CID 25229189
(3R,7aS,11aS)-8-butyl-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-one (PubChem CID 25229189) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (3R,7aS,11aS)-8-butyl-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-one.
| Compound Name | (3R,7aS,11aS)-8-butyl-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-one |
|---|---|
| PubChem CID | 25229189 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (3R,7aS,11aS)-8-butyl-3-phenyl-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-one |
| SMILES | CCCCC1=CCC[C@@]23OC[C@@H](c4ccccc4)N2C(=O)CC[C@@H]13 |
| InChI | InChI=1S/C21H27NO2/c1-2-3-8-16-11-7-14-21-18(16)12-13-20(23)22(21)19(15-24-21)17-9-5-4-6-10-17/h4-6,9-11,18-19H,2-3,7-8,12-15H2,1H3/t18-,19-,21-/m0/s1 |
| InChIKey | ZADLVLCCNQSNKQ-ZJOUEHCJSA-N |
| XLogP | 4.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|