C13H27NO5 — CID 25229260
(2R,3S)-4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxybutane-1,2,3-triol (PubChem CID 25229260) has the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. Its IUPAC name is (2R,3S)-4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxybutane-1,2,3-triol.
| Compound Name | (2R,3S)-4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxybutane-1,2,3-triol |
|---|---|
| PubChem CID | 25229260 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | (2R,3S)-4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxybutane-1,2,3-triol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1OC[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H27NO5/c1-12(2)5-9(16)6-13(3,4)14(12)19-8-11(18)10(17)7-15/h9-11,15-18H,5-8H2,1-4H3/t10-,11+/m1/s1 |
| InChIKey | DDQOOUHCLMRYPO-MNOVXSKESA-N |
| XLogP | -0.35 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |