C11H20F3NO2 — CID 25229267
2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethoxy)piperidin-4-ol (PubChem CID 25229267) has the molecular formula C11H20F3NO2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethoxy)piperidin-4-ol.
| Compound Name | 2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethoxy)piperidin-4-ol |
|---|---|
| PubChem CID | 25229267 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(2,2,2-trifluoroethoxy)piperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1OCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO2/c1-9(2)5-8(16)6-10(3,4)15(9)17-7-11(12,13)14/h8,16H,5-7H2,1-4H3 |
| InChIKey | GNXUQVZAMWXCDL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |