C51H57NO8SSi — CID 25229416
[(2R,3S,4R,5E)-5-[tert-butyl(diphenyl)silyl]oxyimino-2,3,4,6-tetrakis(phenylmethoxy)hexyl] methanesulfonate (PubChem CID 25229416) has the molecular formula C51H57NO8SSi and a molecular weight of 872.17 g/mol. Its IUPAC name is [(2R,3S,4R,5E)-5-[tert-butyl(diphenyl)silyl]oxyimino-2,3,4,6-tetrakis(phenylmethoxy)hexyl] methanesulfonate.
| Compound Name | [(2R,3S,4R,5E)-5-[tert-butyl(diphenyl)silyl]oxyimino-2,3,4,6-tetrakis(phenylmethoxy)hexyl] methanesulfonate |
|---|---|
| PubChem CID | 25229416 |
| Molecular Formula | C51H57NO8SSi |
| Molecular Weight | 872.17 g/mol |
| Exact Mass | 871.36 |
| IUPAC Name | [(2R,3S,4R,5E)-5-[tert-butyl(diphenyl)silyl]oxyimino-2,3,4,6-tetrakis(phenylmethoxy)hexyl] methanesulfonate |
| SMILES | CC(C)(C)[Si](O/N=C(\COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COS(C)(=O)=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H57NO8SSi/c1-51(2,3)62(45-31-19-9-20-32-45,46-33-21-10-22-34-46)60-52-47(39-55-35-41-23-11-5-12-24-41)49(57-37-43-27-15-7-16-28-43)50(58-38-44-29-17-8-18-30-44)48(40-59-61(4,53)54)56-36-42-25-13-6-14-26-42/h5-34,48-50H,35-40H2,1-4H3/b52-47+/t48-,49-,50-/m1/s1 |
| InChIKey | KOGACDLKWUXFQA-GAJBAZPXSA-N |
| XLogP | 8.87 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.17 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|