C9H12O5 — CID 25229481
(3aS,6R,6aS)-2,2-dimethyl-6-[(2S)-oxiran-2-yl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 25229481) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (3aS,6R,6aS)-2,2-dimethyl-6-[(2S)-oxiran-2-yl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aS,6R,6aS)-2,2-dimethyl-6-[(2S)-oxiran-2-yl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 25229481 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (3aS,6R,6aS)-2,2-dimethyl-6-[(2S)-oxiran-2-yl]-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@@H]3CO3)OC(=O)[C@H]2O1 |
| InChI | InChI=1S/C9H12O5/c1-9(2)13-6-5(4-3-11-4)12-8(10)7(6)14-9/h4-7H,3H2,1-2H3/t4-,5+,6-,7-/m0/s1 |
| InChIKey | FCXFXNWMBURHLW-VZFHVOOUSA-N |
| XLogP | -0.17 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|