About methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate
methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate (PubChem CID 25229519) has the molecular formula C12H16O5
and a molecular weight of 240.25 g/mol. Its IUPAC name is methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate.
Molecular Properties
| Compound Name | methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate |
| PubChem CID | 25229519 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2CC[C@@H]1C(=O)C2(OC)OC |
| InChI | InChI=1S/C12H16O5/c1-15-11(14)9-6-7-4-5-8(9)10(13)12(7,16-2)17-3/h6-8H,4-5H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | GFCBYMRRDWWYDE-SFYZADRCSA-N |
| XLogP | 0.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate?
The IUPAC name of methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate (CID 25229519) is methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate.
What is the SMILES notation for methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate?
The canonical SMILES for methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate is COC(=O)C1=C[C@H]2CC[C@@H]1C(=O)C2(OC)OC.
What is the InChIKey of methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate?
The InChIKey is GFCBYMRRDWWYDE-SFYZADRCSA-N. The full InChI is InChI=1S/C12H16O5/c1-15-11(14)9-6-7-4-5-8(9)10(13)12(7,16-2)17-3/h6-8H,4-5H2,1-3H3/t7-,8+/m1/s1.
What are the key properties of methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate?
methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate has a molecular weight of 240.25 g/mol, XLogP of 0.68, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1S,4R)-5,5-dimethoxy-6-oxobicyclo[2.2.2]oct-2-ene-2-carboxylate is sourced from PubChem (CID 25229519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).