C16H20N4O — CID 25229883
2-(4-ethyl-4-azaspiro[2.4]heptan-5-yl)-1H-benzimidazole-4-carboxamide (PubChem CID 25229883) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(4-ethyl-4-azaspiro[2.4]heptan-5-yl)-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-(4-ethyl-4-azaspiro[2.4]heptan-5-yl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 25229883 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-(4-ethyl-4-azaspiro[2.4]heptan-5-yl)-1H-benzimidazole-4-carboxamide |
| SMILES | CCN1C(c2nc3c(C(N)=O)cccc3[nH]2)CCC12CC2 |
| InChI | InChI=1S/C16H20N4O/c1-2-20-12(6-7-16(20)8-9-16)15-18-11-5-3-4-10(14(17)21)13(11)19-15/h3-5,12H,2,6-9H2,1H3,(H2,17,21)(H,18,19) |
| InChIKey | DGIXYEVBLMDQDD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |