C31H40N6O5 — CID 25230521
N-(3,5-diacetylphenyl)-10-(3,5-diacetylphenyl)imino-10-[2-(diaminomethylidene)hydrazinyl]decanamide (PubChem CID 25230521) has the molecular formula C31H40N6O5 and a molecular weight of 576.70 g/mol. Its IUPAC name is N-(3,5-diacetylphenyl)-10-(3,5-diacetylphenyl)imino-10-[2-(diaminomethylidene)hydrazinyl]decanamide.
| Compound Name | N-(3,5-diacetylphenyl)-10-(3,5-diacetylphenyl)imino-10-[2-(diaminomethylidene)hydrazinyl]decanamide |
|---|---|
| PubChem CID | 25230521 |
| Molecular Formula | C31H40N6O5 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | N-(3,5-diacetylphenyl)-10-(3,5-diacetylphenyl)imino-10-[2-(diaminomethylidene)hydrazinyl]decanamide |
| SMILES | CC(=O)c1cc(/N=C(/CCCCCCCCC(=O)Nc2cc(C(C)=O)cc(C(C)=O)c2)NN=C(N)N)cc(C(C)=O)c1 |
| InChI | InChI=1S/C31H40N6O5/c1-19(38)23-13-24(20(2)39)16-27(15-23)34-29(36-37-31(32)33)11-9-7-5-6-8-10-12-30(42)35-28-17-25(21(3)40)14-26(18-28)22(4)41/h13-18H,5-12H2,1-4H3,(H,34,36)(H,35,42)(H4,32,33,37) |
| InChIKey | PFRRBFAANXNCEH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 186.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|