About 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine
5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine (PubChem CID 25230560) has the molecular formula C17H19ClN6
and a molecular weight of 342.83 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine |
| PubChem CID | 25230560 |
| Molecular Formula | C17H19ClN6 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine |
| SMILES | CNCc1nc(N)c(-n2nc(C)cc2C)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN6/c1-10-8-11(2)24(23-10)17-16(19)21-14(9-20-3)15(22-17)12-4-6-13(18)7-5-12/h4-8,20H,9H2,1-3H3,(H2,19,21) |
| InChIKey | WKUHBWQPXNPKLD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine?
The IUPAC name of 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine (CID 25230560) is 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine.
What is the SMILES notation for 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine?
The canonical SMILES for 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine is CNCc1nc(N)c(-n2nc(C)cc2C)nc1-c1ccc(Cl)cc1.
What is the InChIKey of 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine?
The InChIKey is WKUHBWQPXNPKLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN6/c1-10-8-11(2)24(23-10)17-16(19)21-14(9-20-3)15(22-17)12-4-6-13(18)7-5-12/h4-8,20H,9H2,1-3H3,(H2,19,21).
What are the key properties of 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine?
5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine has a molecular weight of 342.83 g/mol, XLogP of 2.90, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-3-(3,5-dimethylpyrazol-1-yl)-6-(methylaminomethyl)pyrazin-2-amine is sourced from PubChem (CID 25230560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).