About 2-(N-ethylanilino)-1,3-benzothiazin-4-one
2-(N-ethylanilino)-1,3-benzothiazin-4-one (PubChem CID 25230882) has the molecular formula C16H14N2OS
and a molecular weight of 282.37 g/mol. Its IUPAC name is 2-(N-ethylanilino)-1,3-benzothiazin-4-one.
Molecular Properties
| Compound Name | 2-(N-ethylanilino)-1,3-benzothiazin-4-one |
| PubChem CID | 25230882 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-(N-ethylanilino)-1,3-benzothiazin-4-one |
| SMILES | CCN(c1ccccc1)c1nc(=O)c2ccccc2s1 |
| InChI | InChI=1S/C16H14N2OS/c1-2-18(12-8-4-3-5-9-12)16-17-15(19)13-10-6-7-11-14(13)20-16/h3-11H,2H2,1H3 |
| InChIKey | NYJOYYZAKBSRPL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(N-ethylanilino)-1,3-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-ethylanilino)-1,3-benzothiazin-4-one?
The IUPAC name of 2-(N-ethylanilino)-1,3-benzothiazin-4-one (CID 25230882) is 2-(N-ethylanilino)-1,3-benzothiazin-4-one.
What is the SMILES notation for 2-(N-ethylanilino)-1,3-benzothiazin-4-one?
The canonical SMILES for 2-(N-ethylanilino)-1,3-benzothiazin-4-one is CCN(c1ccccc1)c1nc(=O)c2ccccc2s1.
What is the InChIKey of 2-(N-ethylanilino)-1,3-benzothiazin-4-one?
The InChIKey is NYJOYYZAKBSRPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2OS/c1-2-18(12-8-4-3-5-9-12)16-17-15(19)13-10-6-7-11-14(13)20-16/h3-11H,2H2,1H3.
What are the key properties of 2-(N-ethylanilino)-1,3-benzothiazin-4-one?
2-(N-ethylanilino)-1,3-benzothiazin-4-one has a molecular weight of 282.37 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-ethylanilino)-1,3-benzothiazin-4-one is sourced from PubChem (CID 25230882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).