About 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine
2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine (PubChem CID 25230953) has the molecular formula C7H5Cl2N3
and a molecular weight of 202.04 g/mol. Its IUPAC name is 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine |
| PubChem CID | 25230953 |
| Molecular Formula | C7H5Cl2N3 |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine |
| SMILES | Cn1ccc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C7H5Cl2N3/c1-12-3-2-4-5(8)10-7(9)11-6(4)12/h2-3H,1H3 |
| InChIKey | WIROGLUDZOMAPT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine?
The IUPAC name of 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine (CID 25230953) is 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine is Cn1ccc2c(Cl)nc(Cl)nc21.
What is the InChIKey of 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine?
The InChIKey is WIROGLUDZOMAPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2N3/c1-12-3-2-4-5(8)10-7(9)11-6(4)12/h2-3H,1H3.
What are the key properties of 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine?
2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine has a molecular weight of 202.04 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-7-methylpyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 25230953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).