About 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine
7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine (PubChem CID 25231163) has the molecular formula C12H7Cl2N3O2S
and a molecular weight of 328.18 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine |
| PubChem CID | 25231163 |
| Molecular Formula | C12H7Cl2N3O2S |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C12H7Cl2N3O2S/c13-10-9-6-7-17(11(9)16-12(14)15-10)20(18,19)8-4-2-1-3-5-8/h1-7H |
| InChIKey | ZGWRYMWYEXGDNI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine?
The IUPAC name of 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine (CID 25231163) is 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine is O=S(=O)(c1ccccc1)n1ccc2c(Cl)nc(Cl)nc21.
What is the InChIKey of 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine?
The InChIKey is ZGWRYMWYEXGDNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl2N3O2S/c13-10-9-6-7-17(11(9)16-12(14)15-10)20(18,19)8-4-2-1-3-5-8/h1-7H.
What are the key properties of 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine?
7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine has a molecular weight of 328.18 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(benzenesulfonyl)-2,4-dichloropyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 25231163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).