C39H51NO6 — CID 25231295
4-O-[6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexyl] 1-O-methyl butanedioate (PubChem CID 25231295) has the molecular formula C39H51NO6 and a molecular weight of 629.84 g/mol. Its IUPAC name is 4-O-[6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 25231295 |
| Molecular Formula | C39H51NO6 |
| Molecular Weight | 629.84 g/mol |
| Exact Mass | 629.37 |
| IUPAC Name | 4-O-[6-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methylanilino]hexyl] 1-O-methyl butanedioate |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)CCCCCCOC(=O)CCC(=O)OC)cc3)C[C@@]21C |
| InChI | InChI=1S/C39H51NO6/c1-5-21-39(44)22-20-34-32-16-12-28-25-30(41)15-17-31(28)37(32)33(26-38(34,39)2)27-10-13-29(14-11-27)40(3)23-8-6-7-9-24-46-36(43)19-18-35(42)45-4/h10-11,13-14,25,32-34,44H,6-9,12,15-20,22-24,26H2,1-4H3/t32-,33+,34-,38-,39-/m0/s1 |
| InChIKey | SRKZUAQLHOWHDA-NVUQLSLKSA-N |
| XLogP | 6.83 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.84 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|