C28H37NO2 — CID 25231587
tert-butyl (1S,2Z,8R)-8-[benzyl-[(1R)-1-phenylethyl]amino]cyclooct-2-ene-1-carboxylate (PubChem CID 25231587) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is tert-butyl (1S,2Z,8R)-8-[benzyl-[(1R)-1-phenylethyl]amino]cyclooct-2-ene-1-carboxylate.
| Compound Name | tert-butyl (1S,2Z,8R)-8-[benzyl-[(1R)-1-phenylethyl]amino]cyclooct-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 25231587 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | tert-butyl (1S,2Z,8R)-8-[benzyl-[(1R)-1-phenylethyl]amino]cyclooct-2-ene-1-carboxylate |
| SMILES | C[C@H](c1ccccc1)N(Cc1ccccc1)[C@@H]1CCCC/C=C\[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H37NO2/c1-22(24-17-11-8-12-18-24)29(21-23-15-9-7-10-16-23)26-20-14-6-5-13-19-25(26)27(30)31-28(2,3)4/h7-13,15-19,22,25-26H,5-6,14,20-21H2,1-4H3/b19-13-/t22-,25+,26-/m1/s1 |
| InChIKey | OMUDCLIXSOCEAP-JZQTURKBSA-N |
| XLogP | 6.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|