C28H24N2 — CID 25231638
(4S,5R)-1-benzyl-2,4,5-triphenyl-4,5-dihydroimidazole (PubChem CID 25231638) has the molecular formula C28H24N2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (4S,5R)-1-benzyl-2,4,5-triphenyl-4,5-dihydroimidazole.
| Compound Name | (4S,5R)-1-benzyl-2,4,5-triphenyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 25231638 |
| Molecular Formula | C28H24N2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (4S,5R)-1-benzyl-2,4,5-triphenyl-4,5-dihydroimidazole |
| SMILES | c1ccc(CN2C(c3ccccc3)=N[C@@H](c3ccccc3)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N2/c1-5-13-22(14-6-1)21-30-27(24-17-9-3-10-18-24)26(23-15-7-2-8-16-23)29-28(30)25-19-11-4-12-20-25/h1-20,26-27H,21H2/t26-,27+/m0/s1 |
| InChIKey | VSOVRPJUEZLLSA-RRPNLBNLSA-N |
| XLogP | 6.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |