C36H30N2O2 — CID 25231640
benzyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate (PubChem CID 25231640) has the molecular formula C36H30N2O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is benzyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate.
| Compound Name | benzyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 25231640 |
| Molecular Formula | C36H30N2O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | benzyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@]1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C36H30N2O2/c39-35(40-27-29-18-8-2-9-19-29)36(32-24-14-5-15-25-32)33(30-20-10-3-11-21-30)38(26-28-16-6-1-7-17-28)34(37-36)31-22-12-4-13-23-31/h1-25,33H,26-27H2/t33-,36-/m1/s1 |
| InChIKey | FUKKFMWPMLTLFH-YYFXGUOYSA-N |
| XLogP | 7.33 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |