About N'-benzylethanimidamide;hydrobromide
N'-benzylethanimidamide;hydrobromide (PubChem CID 25231659) has the molecular formula C9H13BrN2
and a molecular weight of 229.12 g/mol. Its IUPAC name is N'-benzylethanimidamide;hydrobromide.
Molecular Properties
| Compound Name | N'-benzylethanimidamide;hydrobromide |
| PubChem CID | 25231659 |
| Molecular Formula | C9H13BrN2 |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | N'-benzylethanimidamide;hydrobromide |
| SMILES | Br.C/C(N)=N\Cc1ccccc1 |
| InChI | InChI=1S/C9H12N2.BrH/c1-8(10)11-7-9-5-3-2-4-6-9;/h2-6H,7H2,1H3,(H2,10,11);1H |
| InChIKey | RUQJDXJQOUUQHG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-benzylethanimidamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzylethanimidamide;hydrobromide?
The IUPAC name of N'-benzylethanimidamide;hydrobromide (CID 25231659) is N'-benzylethanimidamide;hydrobromide.
What is the SMILES notation for N'-benzylethanimidamide;hydrobromide?
The canonical SMILES for N'-benzylethanimidamide;hydrobromide is Br.C/C(N)=N\Cc1ccccc1.
What is the InChIKey of N'-benzylethanimidamide;hydrobromide?
The InChIKey is RUQJDXJQOUUQHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.BrH/c1-8(10)11-7-9-5-3-2-4-6-9;/h2-6H,7H2,1H3,(H2,10,11);1H.
What are the key properties of N'-benzylethanimidamide;hydrobromide?
N'-benzylethanimidamide;hydrobromide has a molecular weight of 229.12 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzylethanimidamide;hydrobromide is sourced from PubChem (CID 25231659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).