C31H28N2O2 — CID 25231810
ethyl (4S,5S)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate (PubChem CID 25231810) has the molecular formula C31H28N2O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is ethyl (4S,5S)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate.
| Compound Name | ethyl (4S,5S)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 25231810 |
| Molecular Formula | C31H28N2O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | ethyl (4S,5S)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
| SMILES | CCOC(=O)[C@@]1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H28N2O2/c1-2-35-30(34)31(27-21-13-6-14-22-27)28(25-17-9-4-10-18-25)33(23-24-15-7-3-8-16-24)29(32-31)26-19-11-5-12-20-26/h3-22,28H,2,23H2,1H3/t28-,31-/m0/s1 |
| InChIKey | PVUSNWSCRYFKFI-IZEXYCQBSA-N |
| XLogP | 6.15 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |