C27H50O2Si2 — CID 25232106
tert-butyl-dimethyl-[(1S,5S)-2-methyl-5-prop-1-en-2-yl-3-(2-triethylsilyloxypent-4-yn-2-yl)cyclohex-2-en-1-yl]oxysilane (PubChem CID 25232106) has the molecular formula C27H50O2Si2 and a molecular weight of 462.87 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,5S)-2-methyl-5-prop-1-en-2-yl-3-(2-triethylsilyloxypent-4-yn-2-yl)cyclohex-2-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1S,5S)-2-methyl-5-prop-1-en-2-yl-3-(2-triethylsilyloxypent-4-yn-2-yl)cyclohex-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 25232106 |
| Molecular Formula | C27H50O2Si2 |
| Molecular Weight | 462.87 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,5S)-2-methyl-5-prop-1-en-2-yl-3-(2-triethylsilyloxypent-4-yn-2-yl)cyclohex-2-en-1-yl]oxysilane |
| SMILES | C#CCC(C)(O[Si](CC)(CC)CC)C1=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C(=C)C)C1 |
| InChI | InChI=1S/C27H50O2Si2/c1-14-18-27(11,29-31(15-2,16-3)17-4)24-19-23(21(5)6)20-25(22(24)7)28-30(12,13)26(8,9)10/h1,23,25H,5,15-20H2,2-4,6-13H3/t23-,25-,27?/m0/s1 |
| InChIKey | ZNMPFHSZKJLOMJ-HUSGHDHESA-N |
| XLogP | 8.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.87 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|