C11H20ClN3O3Si — CID 25232171
tert-butyl-[2-(2-chloro-4-nitroimidazol-1-yl)ethoxy]-dimethylsilane (PubChem CID 25232171) has the molecular formula C11H20ClN3O3Si and a molecular weight of 305.84 g/mol. Its IUPAC name is tert-butyl-[2-(2-chloro-4-nitroimidazol-1-yl)ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-(2-chloro-4-nitroimidazol-1-yl)ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 25232171 |
| Molecular Formula | C11H20ClN3O3Si |
| Molecular Weight | 305.84 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | tert-butyl-[2-(2-chloro-4-nitroimidazol-1-yl)ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1cc([N+](=O)[O-])nc1Cl |
| InChI | InChI=1S/C11H20ClN3O3Si/c1-11(2,3)19(4,5)18-7-6-14-8-9(15(16)17)13-10(14)12/h8H,6-7H2,1-5H3 |
| InChIKey | XBUDFNRFPHKHQB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|