C7H9N3O3 — CID 25232352
(6R)-3-nitro-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-ol (PubChem CID 25232352) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is (6R)-3-nitro-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-ol.
| Compound Name | (6R)-3-nitro-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-ol |
|---|---|
| PubChem CID | 25232352 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | (6R)-3-nitro-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-ol |
| SMILES | O=[N+]([O-])c1cnc2n1C[C@H](O)CC2 |
| InChI | InChI=1S/C7H9N3O3/c11-5-1-2-6-8-3-7(10(12)13)9(6)4-5/h3,5,11H,1-2,4H2/t5-/m1/s1 |
| InChIKey | JEVAXXKJSULOMY-RXMQYKEDSA-N |
| XLogP | 0.10 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|