C23H27NO3 — CID 25232465
(4S,5R)-3-[(2R,3R)-2,3-dimethylhexanoyl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 25232465) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is (4S,5R)-3-[(2R,3R)-2,3-dimethylhexanoyl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[(2R,3R)-2,3-dimethylhexanoyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 25232465 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (4S,5R)-3-[(2R,3R)-2,3-dimethylhexanoyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@@H](C)[C@@H](C)C(=O)N1C(=O)O[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H27NO3/c1-4-11-16(2)17(3)22(25)24-20(18-12-7-5-8-13-18)21(27-23(24)26)19-14-9-6-10-15-19/h5-10,12-17,20-21H,4,11H2,1-3H3/t16-,17-,20+,21-/m1/s1 |
| InChIKey | RFSKARGRTRFHHW-SGLNWRHMSA-N |
| XLogP | 5.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |