C17H21NO3 — CID 25232471
(2S)-1-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,5-dihydropyridin-6-one (PubChem CID 25232471) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2S)-1-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,5-dihydropyridin-6-one.
| Compound Name | (2S)-1-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,5-dihydropyridin-6-one |
|---|---|
| PubChem CID | 25232471 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (2S)-1-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,5-dihydropyridin-6-one |
| SMILES | CC1(C)OC[C@H]([C@@H]2C=CCC(=O)N2Cc2ccccc2)O1 |
| InChI | InChI=1S/C17H21NO3/c1-17(2)20-12-15(21-17)14-9-6-10-16(19)18(14)11-13-7-4-3-5-8-13/h3-9,14-15H,10-12H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | DCTVZXHWPVDDAV-LSDHHAIUSA-N |
| XLogP | 2.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|