C14H12O5 — CID 25232671
[(1S,2R,3S,4R)-3-but-2-ynoyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate (PubChem CID 25232671) has the molecular formula C14H12O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-3-but-2-ynoyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate.
| Compound Name | [(1S,2R,3S,4R)-3-but-2-ynoyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate |
|---|---|
| PubChem CID | 25232671 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | [(1S,2R,3S,4R)-3-but-2-ynoyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate |
| SMILES | CC#CC(=O)O[C@@H]1[C@H](OC(=O)C#CC)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C14H12O5/c1-3-5-11(15)18-13-9-7-8-10(17-9)14(13)19-12(16)6-4-2/h7-10,13-14H,1-2H3/t9-,10+,13+,14- |
| InChIKey | WXAIJXQDNQPKQZ-DHPDLVEQSA-N |
| XLogP | 0.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|