C14H12F3N3O5S — CID 25232902
(6S)-2-nitro-6-[[4-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8-oxide (PubChem CID 25232902) has the molecular formula C14H12F3N3O5S and a molecular weight of 391.33 g/mol. Its IUPAC name is (6S)-2-nitro-6-[[4-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8-oxide.
| Compound Name | (6S)-2-nitro-6-[[4-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8-oxide |
|---|---|
| PubChem CID | 25232902 |
| Molecular Formula | C14H12F3N3O5S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | (6S)-2-nitro-6-[[4-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8-oxide |
| SMILES | O=[N+]([O-])c1cn2c(n1)S(=O)C[C@@H](OCc1ccc(OC(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C14H12F3N3O5S/c15-14(16,17)25-10-3-1-9(2-4-10)7-24-11-5-19-6-12(20(21)22)18-13(19)26(23)8-11/h1-4,6,11H,5,7-8H2/t11-,26?/m0/s1 |
| InChIKey | ICUHTMCUDQNKDK-AIGWJHGLSA-N |
| XLogP | 2.40 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|