C15H15F3N4O4 — CID 25233067
(6S)-2-nitro-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine (PubChem CID 25233067) has the molecular formula C15H15F3N4O4 and a molecular weight of 372.30 g/mol. Its IUPAC name is (6S)-2-nitro-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine.
| Compound Name | (6S)-2-nitro-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
|---|---|
| PubChem CID | 25233067 |
| Molecular Formula | C15H15F3N4O4 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (6S)-2-nitro-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](NCCc1ccc(OC(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C15H15F3N4O4/c16-15(17,18)26-12-3-1-10(2-4-12)5-6-19-11-7-21-8-13(22(23)24)20-14(21)25-9-11/h1-4,8,11,19H,5-7,9H2/t11-/m0/s1 |
| InChIKey | PKNYKECSJOQQDI-NSHDSACASA-N |
| XLogP | 2.28 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|